CAS 19978-25-7 appears in our catalog under these names: 2,6-Dimethoxy-4-nitrophenol, 95%, 2,6-Dimethoxy-4-nitrophenol 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
2,6-dimethoxy-4-nitrophenol (CAS 19978-25-7) is a chemical compound with the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. IUPAC name: 2,6-dimethoxy-4-nitrophenol. InChIKey: PDFATCIPSRONEB-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 2,6-dimethoxy-4-nitrophenol |
| InChIKey | PDFATCIPSRONEB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)