CAS 7158-91-0 appears in our catalog under these names: 4,5-Dimethoxy-2-nitrophenol, 98%, 4,5-Dimethoxy-2-nitrophenol 97%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
4,5-dimethoxy-2-nitrophenol (CAS 7158-91-0) is a chemical compound with the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. IUPAC name: 4,5-dimethoxy-2-nitrophenol. InChIKey: KBEJHHWQKHGDNC-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 4,5-dimethoxy-2-nitrophenol |
| InChIKey | KBEJHHWQKHGDNC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])O)OC |
Computed by PubChem (NCBI)