CAS 32905-09-2 appears in our catalog under these names: 2,3-Dimethoxy-5-nitrophenol, 95%, 2，3–Dimethoxy–5–nitrophenol, 2,3-Dimethoxy-5-nitrophenol 95%, 2,3-Dimethoxy-5-nitrophenol, 95%, 95%, 2,3-Dimethoxy-5-nitrophenol, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 10g.
2,3-dimethoxy-5-nitrophenol (CAS 32905-09-2) is a chemical compound with the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. IUPAC name: 2,3-dimethoxy-5-nitrophenol. InChIKey: OHKOOWDMYYNFBX-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 2,3-dimethoxy-5-nitrophenol |
| InChIKey | OHKOOWDMYYNFBX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)