CAS 66428-09-9 is the registry number for rel-(2S,5S,Z)-3-(2-Hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3Z,5S)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 66428-09-9) is a chemical compound with the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. IUPAC name: (2S,3Z,5S)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: HZZVJAQRINQKSD-WHJCQOFKSA-N.
| Molecular formula | C8H9NO5 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | (2S,3Z,5S)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | HZZVJAQRINQKSD-WHJCQOFKSA-N |
| SMILES | C1[C@H]2N(C1=O)[C@@H](/C(=C/CO)/O2)C(=O)O |
Computed by PubChem (NCBI)