Products 2856019-51-5
CAS 2856019-51-5 is the registry number for 6-Oxo-5-azaspiro[2.4]heptane-4,4-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-oxo-5-azaspiro[2.4]heptane-4,4-dicarboxylic acid (CAS 2856019-51-5) is a chemical compound with the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. IUPAC name: 6-oxo-5-azaspiro[2.4]heptane-4,4-dicarboxylic acid. InChIKey: IYNFRBQOZZFKOB-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 6-oxo-5-azaspiro[2.4]heptane-4,4-dicarboxylic acid |
| InChIKey | IYNFRBQOZZFKOB-UHFFFAOYSA-N |
| SMILES | C1CC12CC(=O)NC2(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)