CAS 1890665-98-1 appears in our catalog under these names: 5-(2-Chloroethyl)-2,2-difluoro-2H-1,3-benzodioxole, 95%, 5-(2-Chloroethyl)-2,2-difluoro-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(2-chloroethyl)-2,2-difluoro-1,3-benzodioxole (CAS 1890665-98-1) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 5-(2-chloroethyl)-2,2-difluoro-1,3-benzodioxole. InChIKey: MGMBFGMMPWSYMJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 5-(2-chloroethyl)-2,2-difluoro-1,3-benzodioxole |
| InChIKey | MGMBFGMMPWSYMJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CCCl)OC(O2)(F)F |
Computed by PubChem (NCBI)