Products 1891551-12-4
CAS 1891551-12-4 is the registry number for ethyl 2-(2,6-difluoro-3-methylphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(2,6-difluoro-3-methylphenyl)-2-oxoacetate (CAS 1891551-12-4) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: ethyl 2-(2,6-difluoro-3-methylphenyl)-2-oxoacetate. InChIKey: XIFCZPBXSAFYRU-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | ethyl 2-(2,6-difluoro-3-methylphenyl)-2-oxoacetate |
| InChIKey | XIFCZPBXSAFYRU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=CC(=C1F)C)F |
Computed by PubChem (NCBI)