CAS 1891994-61-8 is the registry number for 3-Bromo-2,4-dimethoxybenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-bromo-2,4-dimethoxybenzonitrile (CAS 1891994-61-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 3-bromo-2,4-dimethoxybenzonitrile. InChIKey: POIHJVLHCRGRQW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 3-bromo-2,4-dimethoxybenzonitrile |
| InChIKey | POIHJVLHCRGRQW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C#N)OC)Br |
Computed by PubChem (NCBI)