Products 1892738-82-7
CAS 1892738-82-7 is the registry number for 4-Fluoro-3-methylbenzo[d]isoxazole-7-carbaldehyde, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
4-fluoro-3-methyl-1,2-benzoxazole-7-carbaldehyde (CAS 1892738-82-7) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 4-fluoro-3-methyl-1,2-benzoxazole-7-carbaldehyde. InChIKey: VLYZQQVJOAOZDC-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-fluoro-3-methyl-1,2-benzoxazole-7-carbaldehyde |
| InChIKey | VLYZQQVJOAOZDC-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C(C=CC(=C12)F)C=O |
Computed by PubChem (NCBI)