Products 1893645-13-0
CAS 1893645-13-0 is the registry number for 1-(3-Chlorophenyl)-5-azabicyclo[2.1.1]hexane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-chlorophenyl)-5-azabicyclo[2.1.1]hexane (CAS 1893645-13-0) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: 1-(3-chlorophenyl)-5-azabicyclo[2.1.1]hexane. InChIKey: NQXNGRZBVJKOSN-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-5-azabicyclo[2.1.1]hexane |
| InChIKey | NQXNGRZBVJKOSN-UHFFFAOYSA-N |
| SMILES | C1CC2(CC1N2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)