Products 190270-82-7
CAS 190270-82-7 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-amino-6-oxohexanoic acid, 98+%, 98+%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexanoic acid (CAS 190270-82-7) is a chemical compound with the molecular formula C21H22N2O5 and a molecular weight of 382.4 g/mol. IUPAC name: (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexanoic acid. InChIKey: TUMJDHLFTWKDFD-SFHVURJKSA-N.
| Molecular formula | C21H22N2O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexanoic acid |
| InChIKey | TUMJDHLFTWKDFD-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)