Products 1902712-34-8
CAS 1902712-34-8 is the registry number for Antimicrobial agent-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-cyanophenyl)-3-(2-sulfanylphenyl)urea (CAS 1902712-34-8) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 1-(4-cyanophenyl)-3-(2-sulfanylphenyl)urea. InChIKey: LDLRFKOIHQZNJS-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 1-(4-cyanophenyl)-3-(2-sulfanylphenyl)urea |
| InChIKey | LDLRFKOIHQZNJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NC2=CC=C(C=C2)C#N)S |
Computed by PubChem (NCBI)