CAS 1909305-11-8 appears in our catalog under these names: 5,7-Dichloro-6-methylquinoline, 95%, 5,7-Dichloro-6-methylquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5,7-dichloro-6-methylquinoline (CAS 1909305-11-8) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 5,7-dichloro-6-methylquinoline. InChIKey: WVVWGZYMCSTFFY-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 5,7-dichloro-6-methylquinoline |
| InChIKey | WVVWGZYMCSTFFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1Cl)C=CC=N2)Cl |
Computed by PubChem (NCBI)