Products 1909305-97-0
CAS 1909305-97-0 is the registry number for tert-Butyl 2-acetyl-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-acetyl-1,3-thiazole-5-carboxylate (CAS 1909305-97-0) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: tert-butyl 2-acetyl-1,3-thiazole-5-carboxylate. InChIKey: KEJKVDLWCLNDKB-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | tert-butyl 2-acetyl-1,3-thiazole-5-carboxylate |
| InChIKey | KEJKVDLWCLNDKB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC=C(S1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)