CAS 1909316-26-2 appears in our catalog under these names: N-(4-(4-Cyanophenyl)-1,3-thiazol-2-yl)-N-methylformamide, 95%, N-(4-(4-Cyanophenyl)-1,3-thiazol-2-yl)-N-methylformamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-N-methylformamide (CAS 1909316-26-2) is a chemical compound with the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. IUPAC name: N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-N-methylformamide. InChIKey: CPGXCOHEQRHTAR-UHFFFAOYSA-N.
| Molecular formula | C12H9N3OS |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-N-methylformamide |
| InChIKey | CPGXCOHEQRHTAR-UHFFFAOYSA-N |
| SMILES | CN(C=O)C1=NC(=CS1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)