CAS 1909317-03-8 is the registry number for (3-(Pyridin-2-yl)-1H-1,2,4-triazol-5-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methanamine;hydrochloride (CAS 1909317-03-8) is a chemical compound with the molecular formula C8H10ClN5 and a molecular weight of 211.65 g/mol. IUPAC name: (3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methanamine;hydrochloride. InChIKey: TVOIRKURXWAVDZ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN5 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | (3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methanamine;hydrochloride |
| InChIKey | TVOIRKURXWAVDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NNC(=N2)CN.Cl |
Computed by PubChem (NCBI)