Products 191014-76-3
CAS 191014-76-3 is the registry number for (E)-4-(3-fluorophenyl)-4-oxobut-2-enoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-4-(3-fluorophenyl)-4-oxobut-2-enoic acid (CAS 191014-76-3) is a chemical compound with the molecular formula C10H7FO3 and a molecular weight of 194.16 g/mol. IUPAC name: (E)-4-(3-fluorophenyl)-4-oxobut-2-enoic acid. InChIKey: DAAOYINEOMUICE-SNAWJCMRSA-N.
| Molecular formula | C10H7FO3 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | (E)-4-(3-fluorophenyl)-4-oxobut-2-enoic acid |
| InChIKey | DAAOYINEOMUICE-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)