Products 1912-44-3
CAS 1912-44-3 appears in our catalog under these names: 2-(6-Chloro-1H-indol-3-yl)acetic acid, 97%, 97%, 2-(6-Chloro-1H-indol-3-yl)acetic acid, 95%, 2-(6-Chloro-1H-indol-3-yl)acetic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 100mg, 250mg, 1g, 10g.
2-(6-chloro-1H-indol-3-yl)acetic acid (CAS 1912-44-3) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 2-(6-chloro-1H-indol-3-yl)acetic acid. InChIKey: KKJVTNQWFSAWSK-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 2-(6-chloro-1H-indol-3-yl)acetic acid |
| InChIKey | KKJVTNQWFSAWSK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C2CC(=O)O |
Computed by PubChem (NCBI)