Products 1912445-96-5
CAS 1912445-96-5 is the registry number for 4-Bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylic acid, 96%, 96%. Offered by: Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g.
4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylic acid (CAS 1912445-96-5) is a chemical compound with the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. IUPAC name: 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylic acid. InChIKey: ZWCNWPFSOARSPO-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylic acid |
| InChIKey | ZWCNWPFSOARSPO-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=C(C=C2C(=O)O)F)Br)C |
Computed by PubChem (NCBI)