Products 2924092-66-8
CAS 2924092-66-8 appears in our catalog under these names: 3-(4-bromo-2-fluorophenyl)piperidine-2,6-dione, 95%, 3-(4-Bromo-2-fluorophenyl)piperidine-2,6-dione, 95%, 95%, 3-(4-Bromo-2-fluorophenyl)piperidine-2,6-dione, 98.55%, 3-(4-Bromo-2-fluorophenyl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 100 mg, 50 mg, 500 mg.
3-(4-bromo-2-fluorophenyl)piperidine-2,6-dione (CAS 2924092-66-8) is a chemical compound with the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)piperidine-2,6-dione. InChIKey: MPRXUEDEVZEDCE-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)piperidine-2,6-dione |
| InChIKey | MPRXUEDEVZEDCE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)