Products 3059455-81-8
CAS 3059455-81-8 appears in our catalog under these names: CRBN ligand-47, 99.93%, CRBN ligand-47, 98%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: 25 mg, 250mg.
3-(4-bromo-3-fluorophenyl)piperidine-2,6-dione (CAS 3059455-81-8) is a chemical compound with the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. IUPAC name: 3-(4-bromo-3-fluorophenyl)piperidine-2,6-dione. InChIKey: ZGHWERNWIZBUGO-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 3-(4-bromo-3-fluorophenyl)piperidine-2,6-dione |
| InChIKey | ZGHWERNWIZBUGO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)