CAS 396076-60-1 appears in our catalog under these names: 7-Bromo-5-fluoro-1h-indole-2-carboxylic acid ethyl ester, 95%, Ethyl 7–bromo–5–fluoro–1H–indole–2–carboxylate, 1H-Indole-2-carboxylic acid, 7-bromo-5-fluoro-, ethyl ester, 95%, 95%, Ethyl 7-bromo-5-fluoro-1H-indole-2-carboxylate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25g, 10g, 5g, 100mg.
Ethyl 7-bromo-5-fluoro-1H-indole-2-carboxylate (CAS 396076-60-1) is a chemical compound with the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. IUPAC name: ethyl 7-bromo-5-fluoro-1H-indole-2-carboxylate. InChIKey: ZAUJOWOCPLOJNM-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | ethyl 7-bromo-5-fluoro-1H-indole-2-carboxylate |
| InChIKey | ZAUJOWOCPLOJNM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CC(=C2N1)Br)F |
Computed by PubChem (NCBI)