Products 3050687-74-3
CAS 3050687-74-3 is the registry number for CRBN ligand-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3-bromo-2-fluorophenyl)piperidine-2,6-dione (CAS 3050687-74-3) is a chemical compound with the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. IUPAC name: 3-(3-bromo-2-fluorophenyl)piperidine-2,6-dione. InChIKey: UQDDXEIRMVHOQA-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 3-(3-bromo-2-fluorophenyl)piperidine-2,6-dione |
| InChIKey | UQDDXEIRMVHOQA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C(=CC=C2)Br)F |
Computed by PubChem (NCBI)