CAS 383131-71-3 is the registry number for (5-Bromo-7-fluoro-2-methyl-1h-indol-3-yl)acetic acid, 93%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)acetic acid (CAS 383131-71-3) is a chemical compound with the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. IUPAC name: 2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)acetic acid. InChIKey: UXKQFTKBOIMTCE-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)acetic acid |
| InChIKey | UXKQFTKBOIMTCE-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=CC(=C2)Br)F)CC(=O)O |
Computed by PubChem (NCBI)