CAS 191330-82-2 appears in our catalog under these names: (R)-2-(2-BROMOPHENYL)-4-PHENYL-4,5-DIHYDROOXAZOLE, 97%, (R)-2-(2-Bromophenyl)-4-phenyl-4,5-dihydrooxazole, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4R)-2-(2-bromophenyl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 191330-82-2) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: (4R)-2-(2-bromophenyl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: VHKCPSPWIFJAKI-AWEZNQCLSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | (4R)-2-(2-bromophenyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | VHKCPSPWIFJAKI-AWEZNQCLSA-N |
| SMILES | C1[C@H](N=C(O1)C2=CC=CC=C2Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)