Products 2177257-68-8
CAS 2177257-68-8 appears in our catalog under these names: (S)-1-(2-Methoxypyridin-4-yl)ethanamine dihydrochloride, 95%, (S)–1–(2–Methoxypyridin–4–yl)ethanamine dihydrochloride, (S)-1-(2-METHOXYPYRIDIN-4-YL)ETHANAMINE 2HCL, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(1S)-1-(2-methoxy-4-pyridinyl)ethanamine;dihydrochloride (CAS 2177257-68-8) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: (1S)-1-(2-methoxy-4-pyridinyl)ethanamine;dihydrochloride. InChIKey: IHKGPAMFFJTIDG-ILKKLZGPSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | (1S)-1-(2-methoxy-4-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | IHKGPAMFFJTIDG-ILKKLZGPSA-N |
| SMILES | C[C@@H](C1=CC(=NC=C1)OC)N.Cl.Cl |
Computed by PubChem (NCBI)