Products 1914295-40-1
CAS 1914295-40-1 is the registry number for 2-(P-tolyloxy)pyrimidine-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-methylphenoxy)pyrimidine-5-carboxylic acid (CAS 1914295-40-1) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 2-(4-methylphenoxy)pyrimidine-5-carboxylic acid. InChIKey: OSQFSXKXJLTVPC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 2-(4-methylphenoxy)pyrimidine-5-carboxylic acid |
| InChIKey | OSQFSXKXJLTVPC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=NC=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)