CAS 191664-14-9 appears in our catalog under these names: (R)–2–(((tert–Butoxycarbonyl)amino)methyl)–3–methylbutanoic acid, (R)-2-(((tert-Butoxycarbonyl)amino)methyl)-3-methylbutanoic acid, 98%, 98%, (R)-2-(((tert-Butoxycarbonyl)amino)methyl)-3-methylbutanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2R)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid (CAS 191664-14-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2R)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid. InChIKey: IGJIQZVMCRTQQX-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2R)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid |
| InChIKey | IGJIQZVMCRTQQX-QMMMGPOBSA-N |
| SMILES | CC(C)[C@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)