CAS 210346-16-0 appears in our catalog under these names: Boc-(S)-2-(aminomethyl)-3-methylbutanoic acid, 97%, 97%, (S)-2-(((tert-Butoxycarbonyl)amino)methyl)-3-methylbutanoic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid (CAS 210346-16-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid. InChIKey: IGJIQZVMCRTQQX-MRVPVSSYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid |
| InChIKey | IGJIQZVMCRTQQX-MRVPVSSYSA-N |
| SMILES | CC(C)[C@@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)