Products 2639622-05-0

CAS 2639622-05-0 is the registry number for R-4-Fmoc-1,4-oxazepane-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(5R)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1,4-oxazepane-5-carboxylic acid (CAS 2639622-05-0) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (5R)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1,4-oxazepane-5-carboxylic acid. InChIKey: KNOJACBSXCDGLK-LJQANCHMSA-N.

Identity
Molecular formulaC21H21NO5
Molecular weight367.4 g/mol
IUPAC name(5R)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1,4-oxazepane-5-carboxylic acid
InChIKeyKNOJACBSXCDGLK-LJQANCHMSA-N
SMILESC1COCCN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)