CAS 1919877-35-2 is the registry number for N-(4-Cyanophenyl)-glycine-13C6. Offered by: TRC. Available pack sizes: 50mg.
2-[(4-cyano(1,4,5,6-13C4)cyclohexa-1,3,5-trien-1-yl)amino]acetic acid (CAS 1919877-35-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 182.13 g/mol. IUPAC name: 2-[(4-cyano(1,4,5,6-13C4)cyclohexa-1,3,5-trien-1-yl)amino]acetic acid. InChIKey: KJRQMXRCZULRHF-FOEMZXECSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-[(4-cyano(1,4,5,6-13C4)cyclohexa-1,3,5-trien-1-yl)amino]acetic acid |
| InChIKey | KJRQMXRCZULRHF-FOEMZXECSA-N |
| SMILES | C1=[13C]([13CH]=[13CH][13C](=C1)N[13CH2][13C](=O)O)C#N |
Computed by PubChem (NCBI)