Products 1923042-95-8
CAS 1923042-95-8 is the registry number for 3-(Trifluoromethyl)benzene-1,2-diamine dihydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(trifluoromethyl)benzene-1,2-diamine;dihydrochloride (CAS 1923042-95-8) is a chemical compound with the molecular formula C7H9Cl2F3N2 and a molecular weight of 249.06 g/mol. IUPAC name: 3-(trifluoromethyl)benzene-1,2-diamine;dihydrochloride. InChIKey: LJZYJOLALAMWPZ-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 3-(trifluoromethyl)benzene-1,2-diamine;dihydrochloride |
| InChIKey | LJZYJOLALAMWPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)