Products 192705-88-7
CAS 192705-88-7 appears in our catalog under these names: (2S)-3-(4-Hydroxyphenyl)-2-(prop-2-enamido)propanoic acid, 98%, 98%, (2s)-3-(4-Hydroxyphenyl)-2-(prop-2-enamido)propanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg.
(2S)-3-(4-hydroxyphenyl)-2-(prop-2-enoylamino)propanoic acid (CAS 192705-88-7) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-(prop-2-enoylamino)propanoic acid. InChIKey: ISPFRDAWONQRSH-JTQLQIEISA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-(prop-2-enoylamino)propanoic acid |
| InChIKey | ISPFRDAWONQRSH-JTQLQIEISA-N |
| SMILES | C=CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)