CAS 192753-43-8 is the registry number for Aloc-L-Glu(tBu)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(prop-2-enoxycarbonylamino)pentanoic acid (CAS 192753-43-8) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: (2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(prop-2-enoxycarbonylamino)pentanoic acid. InChIKey: OUVALVGZGIGDQM-VIFPVBQESA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | (2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(prop-2-enoxycarbonylamino)pentanoic acid |
| InChIKey | OUVALVGZGIGDQM-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC(=O)OCC=C |
Computed by PubChem (NCBI)