CAS 1928-77-4 is the registry number for 6-Chloro-7-benzylpurine. Offered by: TRC. Available pack sizes: 100mg, 200mg, 250mg.
7-benzyl-6-chloropurine (CAS 1928-77-4) is a chemical compound with the molecular formula C12H9ClN4 and a molecular weight of 244.68 g/mol. IUPAC name: 7-benzyl-6-chloropurine. InChIKey: QOJVQOWYMWBZNC-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4 |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | 7-benzyl-6-chloropurine |
| InChIKey | QOJVQOWYMWBZNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)