CAS 40655-10-5 is the registry number for 2-(3-Chlorophenyl)-2H-benzo[d][1,2,3]triazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)benzotriazol-5-amine (CAS 40655-10-5) is a chemical compound with the molecular formula C12H9ClN4 and a molecular weight of 244.68 g/mol. IUPAC name: 2-(3-chlorophenyl)benzotriazol-5-amine. InChIKey: LLDIDGHVAUHMSE-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4 |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | 2-(3-chlorophenyl)benzotriazol-5-amine |
| InChIKey | LLDIDGHVAUHMSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2N=C3C=CC(=CC3=N2)N |
Computed by PubChem (NCBI)