Products 2050525-56-7
CAS 2050525-56-7 is the registry number for 3-(2-Chloro-4-pyrimidinyl)-1-methyl-1H-pyrrolo[3,2-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2-chloropyrimidin-4-yl)-1-methylpyrrolo[3,2-b]pyridine (CAS 2050525-56-7) is a chemical compound with the molecular formula C12H9ClN4 and a molecular weight of 244.68 g/mol. IUPAC name: 3-(2-chloropyrimidin-4-yl)-1-methylpyrrolo[3,2-b]pyridine. InChIKey: AYWXQGHPQPPXKS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4 |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | 3-(2-chloropyrimidin-4-yl)-1-methylpyrrolo[3,2-b]pyridine |
| InChIKey | AYWXQGHPQPPXKS-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC=N2)C3=NC(=NC=C3)Cl |
Computed by PubChem (NCBI)