CAS 56383-42-7 is the registry number for 6-Chloro-3-(4-methylphenyl)-(1,2,4)triazolo(4,3-b)pyridazine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-chloro-3-(4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 56383-42-7) is a chemical compound with the molecular formula C12H9ClN4 and a molecular weight of 244.68 g/mol. IUPAC name: 6-chloro-3-(4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: IREBWCSJHJAMDT-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4 |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | 6-chloro-3-(4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | IREBWCSJHJAMDT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)