CAS 650628-11-8 is the registry number for 4-Chloro-1-M-tolyl-1H-pyrazolo(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine (CAS 650628-11-8) is a chemical compound with the molecular formula C12H9ClN4 and a molecular weight of 244.68 g/mol. IUPAC name: 4-chloro-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine. InChIKey: DLHSWXBXKPTYSR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4 |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | 4-chloro-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | DLHSWXBXKPTYSR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C3=C(C=N2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)