CAS 40655-09-2 is the registry number for 2-(4-Chlorophenyl)-2h-1,2,3-benzotriazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-chlorophenyl)benzotriazol-5-amine (CAS 40655-09-2) is a chemical compound with the molecular formula C12H9ClN4 and a molecular weight of 244.68 g/mol. IUPAC name: 2-(4-chlorophenyl)benzotriazol-5-amine. InChIKey: GEQWBCPSXJTWRI-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4 |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)benzotriazol-5-amine |
| InChIKey | GEQWBCPSXJTWRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2N=C3C=CC(=CC3=N2)N)Cl |
Computed by PubChem (NCBI)