Products 1928767-23-0
CAS 1928767-23-0 appears in our catalog under these names: 1,3-Dioxoisoindolin-2-yl 2,2-dimethylbutanoate, 97%, 1,3-Dioxoisoindolin-2-yl 2,2-dimethylbutanoate, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g.
(1,3-dioxoisoindol-2-yl) 2,2-dimethylbutanoate (CAS 1928767-23-0) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2,2-dimethylbutanoate. InChIKey: GFANGMAVENUUIM-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2,2-dimethylbutanoate |
| InChIKey | GFANGMAVENUUIM-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)