CAS 1932010-96-2 is the registry number for (1S,2R)-2-(Benzyloxycarbonylamino)cyclopentanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
Cis-(1S,2R)-2-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 1932010-96-2) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: cis-(1S,2R)-2-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: NVZVMVSTQZDUJQ-NWDGAFQWSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | cis-(1S,2R)-2-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | NVZVMVSTQZDUJQ-NWDGAFQWSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)