CAS 625095-27-4 appears in our catalog under these names: (1R,2S)-2-(((Benzyloxy)carbonyl)amino)cyclopentane-1-carboxylic acid, 97%, (1R,2S)-2-{[(benzyloxy)carbonyl]amino}cyclopentane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Cis-(1R,2S)-2-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 625095-27-4) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: cis-(1R,2S)-2-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: NVZVMVSTQZDUJQ-NEPJUHHUSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | cis-(1R,2S)-2-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | NVZVMVSTQZDUJQ-NEPJUHHUSA-N |
| SMILES | C1C[C@H]([C@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)