CAS 1932087-73-4 is the registry number for Fmoc-3,4-dehydro-L-Val-OH. Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbut-3-enoic acid (CAS 1932087-73-4) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbut-3-enoic acid. InChIKey: KSDLNKHXKRYOST-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbut-3-enoic acid |
| InChIKey | KSDLNKHXKRYOST-SFHVURJKSA-N |
| SMILES | CC(=C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)