Products 1932803-06-9
CAS 1932803-06-9 is the registry number for (1R,3S,4R)-4-{[(tert-butoxy)carbonyl]amino}-3-fluorocyclohexane-1-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R,3S,4R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 1932803-06-9) is a chemical compound with the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. IUPAC name: (1R,3S,4R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: AOLVWWJCRLDSGK-HRDYMLBCSA-N.
| Molecular formula | C12H20FNO4 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | (1R,3S,4R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | AOLVWWJCRLDSGK-HRDYMLBCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](C[C@@H]1F)C(=O)O |
Computed by PubChem (NCBI)