CAS 1933596-07-6 appears in our catalog under these names: 6,6-Dimethyl-1H,4H,6H-furo(3,4-c)pyrazole-3-carboxylic acid, 95%, 6,6-Dimethyl-1H,4H,6H-furo(3,4-c)pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6,6-dimethyl-1,4-dihydrofuro[3,4-d]pyrazole-3-carboxylic acid (CAS 1933596-07-6) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 6,6-dimethyl-1,4-dihydrofuro[3,4-d]pyrazole-3-carboxylic acid. InChIKey: XBMYGSKRORVPNY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 6,6-dimethyl-1,4-dihydrofuro[3,4-d]pyrazole-3-carboxylic acid |
| InChIKey | XBMYGSKRORVPNY-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CO1)C(=NN2)C(=O)O)C |
Computed by PubChem (NCBI)