CAS 1934554-90-1 is the registry number for 6,8-Dibromo-1,2-dihydroisoquinolin-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,8-dibromo-2H-isoquinolin-1-one (CAS 1934554-90-1) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 6,8-dibromo-2H-isoquinolin-1-one. InChIKey: IWPPHWZKWNSXMX-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 6,8-dibromo-2H-isoquinolin-1-one |
| InChIKey | IWPPHWZKWNSXMX-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C(C=C(C=C21)Br)Br |
Computed by PubChem (NCBI)