Products 19350-70-0
CAS 19350-70-0 is the registry number for N'-(2-Methoxybenzylidene)-4-methylbenzenesulfonohydrazide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
N-[(E)-(2-methoxyphenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 19350-70-0) is a chemical compound with the molecular formula C15H16N2O3S and a molecular weight of 304.4 g/mol. IUPAC name: N-[(E)-(2-methoxyphenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: DVEDOVARJCVQIU-LFIBNONCSA-N.
| Molecular formula | C15H16N2O3S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | N-[(E)-(2-methoxyphenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | DVEDOVARJCVQIU-LFIBNONCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=CC=C2OC |
Computed by PubChem (NCBI)