Products 19354-50-8
CAS 19354-50-8 is the registry number for 3-Methoxybenzo[b]thiophene-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-methoxy-1-benzothiophene-2-carboxylic acid (CAS 19354-50-8) is a chemical compound with the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. IUPAC name: 3-methoxy-1-benzothiophene-2-carboxylic acid. InChIKey: AFQQPJAVPVTBMW-UHFFFAOYSA-N.
| Molecular formula | C10H8O3S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 3-methoxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | AFQQPJAVPVTBMW-UHFFFAOYSA-N |
| SMILES | COC1=C(SC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Methoxybenzo[b]thiophene-2-carboxylic acid, 3-Methoxybenzo(b)thiophene-3-carboxylic acid, 3-Methoxybenzo(b)thiophene-2-carboxylic acid, 3-methoxy-1-benzothiophene-2-carboxylic acid, Benzo[b]thiophene-2-carboxylicacid, 3-methoxy-, methoxybenzo[b]thiophene carboxylic acid, 3-methoxybenzothiophene-2-carboxylic acid, 3-Methoxy benzothiophene 2-carboxylic acid, 3-Methoxybenzo[b]thiophene-2-carboxylicacid