Products 1936054-65-7
CAS 1936054-65-7 appears in our catalog under these names: 2，4–Dichloro–3，6–dimethylquinoline, 2,4-Dichloro-3,6-dimethylquinoline, 95%, 95%, 2,4-Dichloro-3,6-dimethylquinoline, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-3,6-dimethylquinoline (CAS 1936054-65-7) is a chemical compound with the molecular formula C11H9Cl2N and a molecular weight of 226.10 g/mol. IUPAC name: 2,4-dichloro-3,6-dimethylquinoline. InChIKey: ZCTZXOIGJRSQBL-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,4-dichloro-3,6-dimethylquinoline |
| InChIKey | ZCTZXOIGJRSQBL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C(=C2Cl)C)Cl |
Computed by PubChem (NCBI)